C10H17BO2 — CID 91164707
(2,3-dimethylphenyl)boronic acid;ethane (PubChem CID 91164707) has the molecular formula C10H17BO2 and a molecular weight of 180.06 g/mol. Its IUPAC name is (2,3-dimethylphenyl)boronic acid;ethane.
| Compound Name | (2,3-dimethylphenyl)boronic acid;ethane |
|---|---|
| PubChem CID | 91164707 |
| Molecular Formula | C10H17BO2 |
| Molecular Weight | 180.06 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2,3-dimethylphenyl)boronic acid;ethane |
| SMILES | CC.Cc1cccc(B(O)O)c1C |
| InChI | InChI=1S/C8H11BO2.C2H6/c1-6-4-3-5-8(7(6)2)9(10)11;1-2/h3-5,10-11H,1-2H3;1-2H3 |
| InChIKey | WBUBGXOBJKVPQS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.06 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|