About methoxymethane;(2-methylphenyl)boronic acid
methoxymethane;(2-methylphenyl)boronic acid (PubChem CID 153370115) has the molecular formula C9H15BO3
and a molecular weight of 182.03 g/mol. Its IUPAC name is methoxymethane;(2-methylphenyl)boronic acid.
Molecular Properties
| Compound Name | methoxymethane;(2-methylphenyl)boronic acid |
| PubChem CID | 153370115 |
| Molecular Formula | C9H15BO3 |
| Molecular Weight | 182.03 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | methoxymethane;(2-methylphenyl)boronic acid |
| SMILES | COC.Cc1ccccc1B(O)O |
| InChI | InChI=1S/C7H9BO2.C2H6O/c1-6-4-2-3-5-7(6)8(9)10;1-3-2/h2-5,9-10H,1H3;1-2H3 |
| InChIKey | DOPJFJWRLDXYTL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.03 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;(2-methylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;(2-methylphenyl)boronic acid?
The IUPAC name of methoxymethane;(2-methylphenyl)boronic acid (CID 153370115) is methoxymethane;(2-methylphenyl)boronic acid.
What is the SMILES notation for methoxymethane;(2-methylphenyl)boronic acid?
The canonical SMILES for methoxymethane;(2-methylphenyl)boronic acid is COC.Cc1ccccc1B(O)O.
What is the InChIKey of methoxymethane;(2-methylphenyl)boronic acid?
The InChIKey is DOPJFJWRLDXYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BO2.C2H6O/c1-6-4-2-3-5-7(6)8(9)10;1-3-2/h2-5,9-10H,1H3;1-2H3.
What are the key properties of methoxymethane;(2-methylphenyl)boronic acid?
methoxymethane;(2-methylphenyl)boronic acid has a molecular weight of 182.03 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;(2-methylphenyl)boronic acid is sourced from PubChem (CID 153370115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).