C13H17Br — CID 82088113
1-[(E)-5-bromopent-2-en-2-yl]-2,3-dimethylbenzene (PubChem CID 82088113) has the molecular formula C13H17Br and a molecular weight of 253.18 g/mol. Its IUPAC name is 1-[(E)-5-bromopent-2-en-2-yl]-2,3-dimethylbenzene.
| Compound Name | 1-[(E)-5-bromopent-2-en-2-yl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 82088113 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-[(E)-5-bromopent-2-en-2-yl]-2,3-dimethylbenzene |
| SMILES | C/C(=C\CCBr)c1cccc(C)c1C |
| InChI | InChI=1S/C13H17Br/c1-10-6-4-8-13(12(10)3)11(2)7-5-9-14/h4,6-8H,5,9H2,1-3H3/b11-7+ |
| InChIKey | SEANJRPTNLYUEZ-YRNVUSSQSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|