C18H24O — CID 143733497
(Z)-7-(2,3-dimethylphenyl)-4-methyl-5-methylideneoct-6-en-2-one (PubChem CID 143733497) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (Z)-7-(2,3-dimethylphenyl)-4-methyl-5-methylideneoct-6-en-2-one.
| Compound Name | (Z)-7-(2,3-dimethylphenyl)-4-methyl-5-methylideneoct-6-en-2-one |
|---|---|
| PubChem CID | 143733497 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (Z)-7-(2,3-dimethylphenyl)-4-methyl-5-methylideneoct-6-en-2-one |
| SMILES | C=C(/C=C(/C)c1cccc(C)c1C)C(C)CC(C)=O |
| InChI | InChI=1S/C18H24O/c1-12-8-7-9-18(17(12)6)15(4)10-13(2)14(3)11-16(5)19/h7-10,14H,2,11H2,1,3-6H3/b15-10- |
| InChIKey | RAYDTRACAGPVDC-GDNBJRDFSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|