C17H18 — CID 18968417
1,2-dimethyl-3-[(E)-1-phenylprop-1-en-2-yl]benzene (PubChem CID 18968417) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(E)-1-phenylprop-1-en-2-yl]benzene.
| Compound Name | 1,2-dimethyl-3-[(E)-1-phenylprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 18968417 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,2-dimethyl-3-[(E)-1-phenylprop-1-en-2-yl]benzene |
| SMILES | C/C(=C\c1ccccc1)c1cccc(C)c1C |
| InChI | InChI=1S/C17H18/c1-13-8-7-11-17(15(13)3)14(2)12-16-9-5-4-6-10-16/h4-12H,1-3H3/b14-12+ |
| InChIKey | IFPUSAKTWFLYFJ-WYMLVPIESA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|