C20H19ClN2 — CID 123764547
1-[3-[2-(8-chloro-1-azacycloocta-1,3,6,7-tetraen-4-yl)ethenyl]-2-methylphenyl]-2-methylprop-2-en-1-imine (PubChem CID 123764547) has the molecular formula C20H19ClN2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 1-[3-[2-(8-chloro-1-azacycloocta-1,3,6,7-tetraen-4-yl)ethenyl]-2-methylphenyl]-2-methylprop-2-en-1-imine.
| Compound Name | 1-[3-[2-(8-chloro-1-azacycloocta-1,3,6,7-tetraen-4-yl)ethenyl]-2-methylphenyl]-2-methylprop-2-en-1-imine |
|---|---|
| PubChem CID | 123764547 |
| Molecular Formula | C20H19ClN2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[3-[2-(8-chloro-1-azacycloocta-1,3,6,7-tetraen-4-yl)ethenyl]-2-methylphenyl]-2-methylprop-2-en-1-imine |
| SMILES | [H]/N=C(\C(=C)C)c1cccc(C=CC2=CC=NC(Cl)=C=CC2)c1C |
| InChI | InChI=1S/C20H19ClN2/c1-14(2)20(22)18-8-5-7-17(15(18)3)11-10-16-6-4-9-19(21)23-13-12-16/h4-5,7-8,10-13,22H,1,6H2,2-3H3/b11-10?,16-12?,22-20+,23-13? |
| InChIKey | NFTNJGQQUFNHMA-GGPLTTMKSA-N |
| XLogP | 5.59 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|