C10H9Cl2N — CID 141315845
(E)-4-(2,6-dichlorophenyl)but-3-en-2-imine (PubChem CID 141315845) has the molecular formula C10H9Cl2N and a molecular weight of 214.10 g/mol. Its IUPAC name is (E)-4-(2,6-dichlorophenyl)but-3-en-2-imine.
| Compound Name | (E)-4-(2,6-dichlorophenyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 141315845 |
| Molecular Formula | C10H9Cl2N |
| Molecular Weight | 214.10 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | (E)-4-(2,6-dichlorophenyl)but-3-en-2-imine |
| SMILES | [H]/N=C(C)/C=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H9Cl2N/c1-7(13)5-6-8-9(11)3-2-4-10(8)12/h2-6,13H,1H3/b6-5+,13-7+ |
| InChIKey | DOJAALDIXHMJBN-WOXAVFRBSA-N |
| XLogP | 4.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.10 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|