C17H12Cl2O3 — CID 732601
(4-acetylphenyl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate (PubChem CID 732601) has the molecular formula C17H12Cl2O3 and a molecular weight of 335.19 g/mol. Its IUPAC name is (4-acetylphenyl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate.
| Compound Name | (4-acetylphenyl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 732601 |
| Molecular Formula | C17H12Cl2O3 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (4-acetylphenyl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate |
| SMILES | CC(=O)c1ccc(OC(=O)/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2O3/c1-11(20)12-5-7-13(8-6-12)22-17(21)10-9-14-15(18)3-2-4-16(14)19/h2-10H,1H3/b10-9+ |
| InChIKey | DCFRAUOOLKTDOV-MDZDMXLPSA-N |
| XLogP | 4.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|