C22H13Cl3O3 — CID 6124116
[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-chlorobenzoate (PubChem CID 6124116) has the molecular formula C22H13Cl3O3 and a molecular weight of 431.70 g/mol. Its IUPAC name is [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6124116 |
| Molecular Formula | C22H13Cl3O3 |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)c1ccc(OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H13Cl3O3/c23-18-6-3-7-19(24)16(18)12-13-21(26)14-8-10-15(11-9-14)28-22(27)17-4-1-2-5-20(17)25/h1-13H/b13-12+ |
| InChIKey | KARCCKNDRSAVBB-OUKQBFOZSA-N |
| XLogP | 6.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|