C20H18Cl2O3 — CID 141305455
(E)-3-(2,6-dichlorophenyl)-1-[4-[(Z)-2-hydroxy-3-methylbut-1-enoxy]phenyl]prop-2-en-1-one (PubChem CID 141305455) has the molecular formula C20H18Cl2O3 and a molecular weight of 377.27 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-1-[4-[(Z)-2-hydroxy-3-methylbut-1-enoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-1-[4-[(Z)-2-hydroxy-3-methylbut-1-enoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141305455 |
| Molecular Formula | C20H18Cl2O3 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-1-[4-[(Z)-2-hydroxy-3-methylbut-1-enoxy]phenyl]prop-2-en-1-one |
| SMILES | CC(C)/C(O)=C/Oc1ccc(C(=O)/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2O3/c1-13(2)20(24)12-25-15-8-6-14(7-9-15)19(23)11-10-16-17(21)4-3-5-18(16)22/h3-13,24H,1-2H3/b11-10+,20-12- |
| InChIKey | KFOWOMLYNSQMFY-BBGWFYANSA-N |
| XLogP | 6.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|