C11H12N2 — CID 142523864
2-(2-methyl-3-pyridinyl)penta-1,4-dien-3-imine (PubChem CID 142523864) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(2-methyl-3-pyridinyl)penta-1,4-dien-3-imine.
| Compound Name | 2-(2-methyl-3-pyridinyl)penta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 142523864 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-(2-methyl-3-pyridinyl)penta-1,4-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(=C)c1cccnc1C |
| InChI | InChI=1S/C11H12N2/c1-4-11(12)8(2)10-6-5-7-13-9(10)3/h4-7,12H,1-2H2,3H3/b12-11+ |
| InChIKey | YHZGLJZNUHOPLL-VAWYXSNFSA-N |
| XLogP | 2.61 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|