C10H13N3 — CID 123848006
N'-methyl-1-(2-methyl-3-pyridinyl)propane-1,3-diimine (PubChem CID 123848006) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is N'-methyl-1-(2-methyl-3-pyridinyl)propane-1,3-diimine.
| Compound Name | N'-methyl-1-(2-methyl-3-pyridinyl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123848006 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N'-methyl-1-(2-methyl-3-pyridinyl)propane-1,3-diimine |
| SMILES | [H]/N=C(\C/C=N/C)c1cccnc1C |
| InChI | InChI=1S/C10H13N3/c1-8-9(4-3-6-13-8)10(11)5-7-12-2/h3-4,6-7,11H,5H2,1-2H3/b11-10+,12-7+ |
| InChIKey | KFDOBWYKXOHGRT-MLKCCRLUSA-N |
| XLogP | 1.85 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|