C16H14N6S — CID 90720982
N'-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-1-pyrimidin-2-ylpropane-1,3-diimine (PubChem CID 90720982) has the molecular formula C16H14N6S and a molecular weight of 322.40 g/mol. Its IUPAC name is N'-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-1-pyrimidin-2-ylpropane-1,3-diimine.
| Compound Name | N'-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-1-pyrimidin-2-ylpropane-1,3-diimine |
|---|---|
| PubChem CID | 90720982 |
| Molecular Formula | C16H14N6S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N'-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-1-pyrimidin-2-ylpropane-1,3-diimine |
| SMILES | [H]/N=C(/CC=Nc1sc(-c2cccnc2)nc1C)c1ncccn1 |
| InChI | InChI=1S/C16H14N6S/c1-11-15(23-16(22-11)12-4-2-6-18-10-12)21-9-5-13(17)14-19-7-3-8-20-14/h2-4,6-10,17H,5H2,1H3/b17-13-,21-9? |
| InChIKey | LHRVTPIRRLMQGO-QOXSFRATSA-N |
| XLogP | 3.46 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|