C12H14F3N — CID 146258533
1-[2-methyl-3-(1,1,1-trifluoropropan-2-yl)phenyl]ethanimine (PubChem CID 146258533) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is 1-[2-methyl-3-(1,1,1-trifluoropropan-2-yl)phenyl]ethanimine.
| Compound Name | 1-[2-methyl-3-(1,1,1-trifluoropropan-2-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 146258533 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-[2-methyl-3-(1,1,1-trifluoropropan-2-yl)phenyl]ethanimine |
| SMILES | [H]/N=C(\C)c1cccc(C(C)C(F)(F)F)c1C |
| InChI | InChI=1S/C12H14F3N/c1-7-10(8(2)12(13,14)15)5-4-6-11(7)9(3)16/h4-6,8,16H,1-3H3/b16-9+ |
| InChIKey | WWUYGZRYYKJLTB-CXUHLZMHSA-N |
| XLogP | 4.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|