C12H12F6O — CID 24760546
2,6-bis(1,1,1-trifluoropropan-2-yl)phenol (PubChem CID 24760546) has the molecular formula C12H12F6O and a molecular weight of 286.22 g/mol. Its IUPAC name is 2,6-bis(1,1,1-trifluoropropan-2-yl)phenol.
| Compound Name | 2,6-bis(1,1,1-trifluoropropan-2-yl)phenol |
|---|---|
| PubChem CID | 24760546 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2,6-bis(1,1,1-trifluoropropan-2-yl)phenol |
| SMILES | CC(c1cccc(C(C)C(F)(F)F)c1O)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O/c1-6(11(13,14)15)8-4-3-5-9(10(8)19)7(2)12(16,17)18/h3-7,19H,1-2H3 |
| InChIKey | YOYQGSKNLYGWOJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |