C15H16ClN3 — CID 123618442
(Z)-1-(2-chloro-3-pyridinyl)-3-(6-methyl-4,5-dihydro-3H-azepin-7-yl)prop-2-en-1-imine (PubChem CID 123618442) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is (Z)-1-(2-chloro-3-pyridinyl)-3-(6-methyl-4,5-dihydro-3H-azepin-7-yl)prop-2-en-1-imine.
| Compound Name | (Z)-1-(2-chloro-3-pyridinyl)-3-(6-methyl-4,5-dihydro-3H-azepin-7-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 123618442 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (Z)-1-(2-chloro-3-pyridinyl)-3-(6-methyl-4,5-dihydro-3H-azepin-7-yl)prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\C1=C(C)CCCC=N1)c1cccnc1Cl |
| InChI | InChI=1S/C15H16ClN3/c1-11-5-2-3-9-18-14(11)8-7-13(17)12-6-4-10-19-15(12)16/h4,6-10,17H,2-3,5H2,1H3/b8-7-,17-13- |
| InChIKey | JLLNTFBNNLAYOG-YTALYMLMSA-N |
| XLogP | 4.19 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|