About 5-iminoheptanamide
5-iminoheptanamide (PubChem CID 123928104) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 5-iminoheptanamide.
Molecular Properties
| Compound Name | 5-iminoheptanamide |
| PubChem CID | 123928104 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 5-iminoheptanamide |
| SMILES | [H]/N=C(\CC)CCCC(N)=O |
| InChI | InChI=1S/C7H14N2O/c1-2-6(8)4-3-5-7(9)10/h8H,2-5H2,1H3,(H2,9,10)/b8-6+ |
| InChIKey | WRWIKMMPBOSIDC-SOFGYWHQSA-N |
| XLogP | 1.07 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminoheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminoheptanamide?
The IUPAC name of 5-iminoheptanamide (CID 123928104) is 5-iminoheptanamide.
What is the SMILES notation for 5-iminoheptanamide?
The canonical SMILES for 5-iminoheptanamide is [H]/N=C(\CC)CCCC(N)=O.
What is the InChIKey of 5-iminoheptanamide?
The InChIKey is WRWIKMMPBOSIDC-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H14N2O/c1-2-6(8)4-3-5-7(9)10/h8H,2-5H2,1H3,(H2,9,10)/b8-6+.
What are the key properties of 5-iminoheptanamide?
5-iminoheptanamide has a molecular weight of 142.20 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminoheptanamide is sourced from PubChem (CID 123928104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).