About 2-sulfinylundecanal
2-sulfinylundecanal (PubChem CID 154594703) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 2-sulfinylundecanal.
Molecular Properties
| Compound Name | 2-sulfinylundecanal |
| PubChem CID | 154594703 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-sulfinylundecanal |
| SMILES | CCCCCCCCCC(C=O)=S=O |
| InChI | InChI=1S/C11H20O2S/c1-2-3-4-5-6-7-8-9-11(10-12)14-13/h10H,2-9H2,1H3 |
| InChIKey | LQJCSYYAVXHHJG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfinylundecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfinylundecanal?
The IUPAC name of 2-sulfinylundecanal (CID 154594703) is 2-sulfinylundecanal.
What is the SMILES notation for 2-sulfinylundecanal?
The canonical SMILES for 2-sulfinylundecanal is CCCCCCCCCC(C=O)=S=O.
What is the InChIKey of 2-sulfinylundecanal?
The InChIKey is LQJCSYYAVXHHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-2-3-4-5-6-7-8-9-11(10-12)14-13/h10H,2-9H2,1H3.
What are the key properties of 2-sulfinylundecanal?
2-sulfinylundecanal has a molecular weight of 216.35 g/mol, XLogP of 2.71, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfinylundecanal is sourced from PubChem (CID 154594703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).