About acetaldehyde;undecan-2-one
acetaldehyde;undecan-2-one (PubChem CID 87112507) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is acetaldehyde;undecan-2-one.
Molecular Properties
| Compound Name | acetaldehyde;undecan-2-one |
| PubChem CID | 87112507 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | acetaldehyde;undecan-2-one |
| SMILES | CC=O.CCCCCCCCCC(C)=O |
| InChI | InChI=1S/C11H22O.C2H4O/c1-3-4-5-6-7-8-9-10-11(2)12;1-2-3/h3-10H2,1-2H3;2H,1H3 |
| InChIKey | FHTVFJLKUFDRQT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;undecan-2-one?
The IUPAC name of acetaldehyde;undecan-2-one (CID 87112507) is acetaldehyde;undecan-2-one.
What is the SMILES notation for acetaldehyde;undecan-2-one?
The canonical SMILES for acetaldehyde;undecan-2-one is CC=O.CCCCCCCCCC(C)=O.
What is the InChIKey of acetaldehyde;undecan-2-one?
The InChIKey is FHTVFJLKUFDRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C2H4O/c1-3-4-5-6-7-8-9-10-11(2)12;1-2-3/h3-10H2,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;undecan-2-one?
acetaldehyde;undecan-2-one has a molecular weight of 214.35 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;undecan-2-one is sourced from PubChem (CID 87112507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).