C14H20N2O5 — CID 108540085
2-hydroxy-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]benzamide (PubChem CID 108540085) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108540085 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-hydroxy-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]benzamide |
| SMILES | COCCOCC(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C14H20N2O5/c1-20-8-9-21-10-13(18)15-6-7-16-14(19)11-4-2-3-5-12(11)17/h2-5,17H,6-10H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | MOEZLQVZSVKYHD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|