C13H19N3O3S — CID 110687852
3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 110687852) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 110687852 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | O=C(CCN1CCCCS1(=O)=O)NCc1ccncc1 |
| InChI | InChI=1S/C13H19N3O3S/c17-13(15-11-12-3-6-14-7-4-12)5-9-16-8-1-2-10-20(16,18)19/h3-4,6-7H,1-2,5,8-11H2,(H,15,17) |
| InChIKey | ADPARYIYCILXEG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |