C14H17N3O3S — CID 110687959
N-(4-cyanophenyl)-3-(1,1-dioxothiazinan-2-yl)propanamide (PubChem CID 110687959) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(1,1-dioxothiazinan-2-yl)propanamide.
| Compound Name | N-(4-cyanophenyl)-3-(1,1-dioxothiazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 110687959 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(4-cyanophenyl)-3-(1,1-dioxothiazinan-2-yl)propanamide |
| SMILES | N#Cc1ccc(NC(=O)CCN2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c15-11-12-3-5-13(6-4-12)16-14(18)7-9-17-8-1-2-10-21(17,19)20/h3-6H,1-2,7-10H2,(H,16,18) |
| InChIKey | YHYQHBMUXXEUBX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |