C13H18N2O3S — CID 110687886
3-(1,1-dioxothiazinan-2-yl)-N-phenylpropanamide (PubChem CID 110687886) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-phenylpropanamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 110687886 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-phenylpropanamide |
| SMILES | O=C(CCN1CCCCS1(=O)=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3S/c16-13(14-12-6-2-1-3-7-12)8-10-15-9-4-5-11-19(15,17)18/h1-3,6-7H,4-5,8-11H2,(H,14,16) |
| InChIKey | TZBUDKHOEUXXGQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |