C13H18N4O2 — CID 110706314
4-acetyl-N-(pyridin-4-ylmethyl)piperazine-1-carboxamide (PubChem CID 110706314) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-acetyl-N-(pyridin-4-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-acetyl-N-(pyridin-4-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110706314 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-acetyl-N-(pyridin-4-ylmethyl)piperazine-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)NCc2ccncc2)CC1 |
| InChI | InChI=1S/C13H18N4O2/c1-11(18)16-6-8-17(9-7-16)13(19)15-10-12-2-4-14-5-3-12/h2-5H,6-10H2,1H3,(H,15,19) |
| InChIKey | HEPJLEGMNQJZEN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |