C18H19F3N4O — CID 113108755
N-(pyridin-4-ylmethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 113108755) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(pyridin-4-ylmethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108755 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccncc1)N1CCN(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H19F3N4O/c19-18(20,21)15-3-1-2-4-16(15)24-9-11-25(12-10-24)17(26)23-13-14-5-7-22-8-6-14/h1-8H,9-13H2,(H,23,26) |
| InChIKey | NGLFNDCBMRNAHT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |