C16H24N2O4S — CID 110687859
3-(1,1-dioxothiazinan-2-yl)-N-[2-(3-methoxyphenyl)ethyl]propanamide (PubChem CID 110687859) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-[2-(3-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-[2-(3-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 110687859 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-[2-(3-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1cccc(CCNC(=O)CCN2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-22-15-6-4-5-14(13-15)7-9-17-16(19)8-11-18-10-2-3-12-23(18,20)21/h4-6,13H,2-3,7-12H2,1H3,(H,17,19) |
| InChIKey | QIQCUMBUGIANAB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |