C15H21FN2O3S — CID 110720940
N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-3-(3-fluorophenyl)propanamide (PubChem CID 110720940) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-3-(3-fluorophenyl)propanamide.
| Compound Name | N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 110720940 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-3-(3-fluorophenyl)propanamide |
| SMILES | O=C(CCc1cccc(F)c1)NCCN1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H21FN2O3S/c16-14-5-3-4-13(12-14)6-7-15(19)17-8-10-18-9-1-2-11-22(18,20)21/h3-5,12H,1-2,6-11H2,(H,17,19) |
| InChIKey | PDJRSOPRSXDMGM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |