C22H23N3O5 — CID 46344339
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanamide (PubChem CID 46344339) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 46344339 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanamide |
| SMILES | O=C(CCN1CCN(Cc2ccccc2)C(=O)C1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H23N3O5/c26-20(23-13-17-6-7-18-19(12-17)30-15-29-18)8-9-24-10-11-25(22(28)21(24)27)14-16-4-2-1-3-5-16/h1-7,12H,8-11,13-15H2,(H,23,26) |
| InChIKey | KVGZYNJZKMLITP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|