C19H15FN2O5 — CID 113202708
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 113202708) has the molecular formula C19H15FN2O5 and a molecular weight of 370.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 113202708 |
| Molecular Formula | C19H15FN2O5 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2cccc(F)c2C1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15FN2O5/c20-13-3-1-2-12-17(13)19(25)22(18(12)24)7-6-16(23)21-9-11-4-5-14-15(8-11)27-10-26-14/h1-5,8H,6-7,9-10H2,(H,21,23) |
| InChIKey | HFLBKTNPAHQHCL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|