C16H19N3O3 — CID 131937873
N-(1,3-benzodioxol-5-ylmethyl)-3-(2-ethylimidazol-1-yl)propanamide (PubChem CID 131937873) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(2-ethylimidazol-1-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2-ethylimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 131937873 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2-ethylimidazol-1-yl)propanamide |
| SMILES | CCc1nccn1CCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19N3O3/c1-2-15-17-6-8-19(15)7-5-16(20)18-10-12-3-4-13-14(9-12)22-11-21-13/h3-4,6,8-9H,2,5,7,10-11H2,1H3,(H,18,20) |
| InChIKey | DVJFCXYHAJHMOU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |