C21H22N2O3 — CID 71840842
N-(1,3-benzodioxol-5-ylmethyl)-3-(1-ethylindol-5-yl)propanamide (PubChem CID 71840842) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(1-ethylindol-5-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1-ethylindol-5-yl)propanamide |
|---|---|
| PubChem CID | 71840842 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1-ethylindol-5-yl)propanamide |
| SMILES | CCn1ccc2cc(CCC(=O)NCc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C21H22N2O3/c1-2-23-10-9-17-11-15(3-6-18(17)23)5-8-21(24)22-13-16-4-7-19-20(12-16)26-14-25-19/h3-4,6-7,9-12H,2,5,8,13-14H2,1H3,(H,22,24) |
| InChIKey | FUIPKMUIIQPGBM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |