C20H20F2N2O — CID 71830169
N-[(2,5-difluorophenyl)methyl]-3-(1-ethylindol-5-yl)propanamide (PubChem CID 71830169) has the molecular formula C20H20F2N2O and a molecular weight of 342.39 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-3-(1-ethylindol-5-yl)propanamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-3-(1-ethylindol-5-yl)propanamide |
|---|---|
| PubChem CID | 71830169 |
| Molecular Formula | C20H20F2N2O |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-3-(1-ethylindol-5-yl)propanamide |
| SMILES | CCn1ccc2cc(CCC(=O)NCc3cc(F)ccc3F)ccc21 |
| InChI | InChI=1S/C20H20F2N2O/c1-2-24-10-9-15-11-14(3-7-19(15)24)4-8-20(25)23-13-16-12-17(21)5-6-18(16)22/h3,5-7,9-12H,2,4,8,13H2,1H3,(H,23,25) |
| InChIKey | NJTZZLHVSPVHQA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |