C17H14ClF4NO — CID 46485685
3-(4-chlorophenyl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 46485685) has the molecular formula C17H14ClF4NO and a molecular weight of 359.75 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 46485685 |
| Molecular Formula | C17H14ClF4NO |
| Molecular Weight | 359.75 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H14ClF4NO/c18-13-5-1-11(2-6-13)3-8-16(24)23-10-12-4-7-14(19)9-15(12)17(20,21)22/h1-2,4-7,9H,3,8,10H2,(H,23,24) |
| InChIKey | OPCNVDQDLGSCRF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |