C18H17F4NO — CID 46485625
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)propanamide (PubChem CID 46485625) has the molecular formula C18H17F4NO and a molecular weight of 339.33 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)propanamide.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 46485625 |
| Molecular Formula | C18H17F4NO |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)NCc2ccc(F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F4NO/c1-12-2-4-13(5-3-12)6-9-17(24)23-11-14-7-8-15(19)10-16(14)18(20,21)22/h2-5,7-8,10H,6,9,11H2,1H3,(H,23,24) |
| InChIKey | BYSAUQGNDQULDX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |