C18H15F6NO2 — CID 78876423
3-[4-(difluoromethoxy)phenyl]-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 78876423) has the molecular formula C18H15F6NO2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 78876423 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCc1ccc(OC(F)F)cc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H15F6NO2/c19-13-5-4-12(15(9-13)18(22,23)24)10-25-16(26)8-3-11-1-6-14(7-2-11)27-17(20)21/h1-2,4-7,9,17H,3,8,10H2,(H,25,26) |
| InChIKey | ZAAFJKJAKYGTRU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |