C27H31BrN2O5 — CID 23943112
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclohexanecarboxamide (PubChem CID 23943112) has the molecular formula C27H31BrN2O5 and a molecular weight of 543.46 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23943112 |
| Molecular Formula | C27H31BrN2O5 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(CCN(C(=O)C2CCCCC2)C2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C27H31BrN2O5/c1-34-23-13-8-18(16-24(23)35-2)14-15-29(26(32)19-6-4-3-5-7-19)22-17-25(31)30(27(22)33)21-11-9-20(28)10-12-21/h8-13,16,19,22H,3-7,14-15,17H2,1-2H3 |
| InChIKey | WSZAOTUKWCKART-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|