C21H27BrN2O3 — CID 23830977
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-tert-butylcyclohexanecarboxamide (PubChem CID 23830977) has the molecular formula C21H27BrN2O3 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-tert-butylcyclohexanecarboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-tert-butylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 23830977 |
| Molecular Formula | C21H27BrN2O3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-tert-butylcyclohexanecarboxamide |
| SMILES | CC(C)(C)N(C(=O)C1CCCCC1)C1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C21H27BrN2O3/c1-21(2,3)24(19(26)14-7-5-4-6-8-14)17-13-18(25)23(20(17)27)16-11-9-15(22)10-12-16/h9-12,14,17H,4-8,13H2,1-3H3 |
| InChIKey | VXVYNMJNIJQMDY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|