C24H32N2O5 — CID 23830979
[4-[3-[cyclohexanecarbonyl(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23830979) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [4-[3-[cyclohexanecarbonyl(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[cyclohexanecarbonyl(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23830979 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [4-[3-[cyclohexanecarbonyl(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CCC(C)(C)N(C(=O)C1CCCCC1)C1CC(=O)N(c2ccc(OC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C24H32N2O5/c1-5-24(3,4)26(22(29)17-9-7-6-8-10-17)20-15-21(28)25(23(20)30)18-11-13-19(14-12-18)31-16(2)27/h11-14,17,20H,5-10,15H2,1-4H3 |
| InChIKey | HWDLOXHDPJSIAZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|