C27H24ClN3O4S — CID 23886885
4-chloro-N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23886885) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 4-chloro-N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23886885 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 4-chloro-N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(CCc3c[nH]c4ccccc34)S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H24ClN3O4S/c1-18-6-10-21(11-7-18)31-26(32)16-25(27(31)33)30(36(34,35)22-12-8-20(28)9-13-22)15-14-19-17-29-24-5-3-2-4-23(19)24/h2-13,17,25,29H,14-16H2,1H3 |
| InChIKey | CRLDPZBVRFJTQF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|