C26H21BrFN3O4S — CID 23830550
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 23830550) has the molecular formula C26H21BrFN3O4S and a molecular weight of 570.44 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23830550 |
| Molecular Formula | C26H21BrFN3O4S |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=C1CC(N(CCc2c[nH]c3ccccc23)S(=O)(=O)c2ccc(F)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H21BrFN3O4S/c27-18-5-9-20(10-6-18)31-25(32)15-24(26(31)33)30(36(34,35)21-11-7-19(28)8-12-21)14-13-17-16-29-23-4-2-1-3-22(17)23/h1-12,16,24,29H,13-15H2 |
| InChIKey | OSKVCERWFJJZPM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|