C27H24N4O6S — CID 25035521
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 25035521) has the molecular formula C27H24N4O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25035521 |
| Molecular Formula | C27H24N4O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(=O)N(CCc1ccc(S(N)(=O)=O)cc1)C1CC(=O)N(c2ccc(-c3nc4ccccc4o3)cc2)C1=O |
| InChI | InChI=1S/C27H24N4O6S/c1-17(32)30(15-14-18-6-12-21(13-7-18)38(28,35)36)23-16-25(33)31(27(23)34)20-10-8-19(9-11-20)26-29-22-4-2-3-5-24(22)37-26/h2-13,23H,14-16H2,1H3,(H2,28,35,36) |
| InChIKey | FEOUKTVSNQOWQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|