C20H25N3O5S — CID 25037934
N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide (PubChem CID 25037934) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 25037934 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C(=O)C3CC3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c21-29(27,28)16-10-8-15(9-11-16)23-18(24)12-17(20(23)26)22(19(25)13-6-7-13)14-4-2-1-3-5-14/h8-11,13-14,17H,1-7,12H2,(H2,21,27,28) |
| InChIKey | AXCYUJMAKYKWES-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|