C27H33N3O4 — CID 23888617
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 23888617) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 23888617 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Cc1cccc(C(=O)N(CCN2CCOCC2)C2CC(=O)N(c3ccc(C(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H33N3O4/c1-19(2)21-7-9-23(10-8-21)30-25(31)18-24(27(30)33)29(12-11-28-13-15-34-16-14-28)26(32)22-6-4-5-20(3)17-22/h4-10,17,19,24H,11-16,18H2,1-3H3 |
| InChIKey | GOXZKAGDCHRUEU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|