C22H30ClN3O4 — CID 23998908
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 23998908) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 23998908 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | CC(C)(C)CC(=O)N(CCN1CCOCC1)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H30ClN3O4/c1-22(2,3)15-20(28)25(9-8-24-10-12-30-13-11-24)18-14-19(27)26(21(18)29)17-6-4-16(23)5-7-17/h4-7,18H,8-15H2,1-3H3 |
| InChIKey | DIGKWCMHCBVJFZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|