C24H27ClN4O6S — CID 25049118
2-(4-chlorophenyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 25049118) has the molecular formula C24H27ClN4O6S and a molecular weight of 535.02 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 25049118 |
| Molecular Formula | C24H27ClN4O6S |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(CCN3CCOCC3)C(=O)Cc3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H27ClN4O6S/c25-18-3-1-17(2-4-18)15-22(30)28(10-9-27-11-13-35-14-12-27)21-16-23(31)29(24(21)32)19-5-7-20(8-6-19)36(26,33)34/h1-8,21H,9-16H2,(H2,26,33,34) |
| InChIKey | QLPBKRDZXUXGIL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|