C22H20ClN3O7S — CID 27915967
(E)-4-[[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 27915967) has the molecular formula C22H20ClN3O7S and a molecular weight of 505.94 g/mol. Its IUPAC name is (E)-4-[[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 27915967 |
| Molecular Formula | C22H20ClN3O7S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (E)-4-[[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | NS(=O)(=O)c1ccc(CCN(C(=O)/C=C/C(=O)O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H20ClN3O7S/c23-15-3-5-16(6-4-15)26-20(28)13-18(22(26)31)25(19(27)9-10-21(29)30)12-11-14-1-7-17(8-2-14)34(24,32)33/h1-10,18H,11-13H2,(H,29,30)(H2,24,32,33)/b10-9+/t18-/m0/s1 |
| InChIKey | WILUMFIWGGASCW-BBVFFXRHSA-N |
| XLogP | 1.33 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|