C24H25N3O8S — CID 3121059
4-[[1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 3121059) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is 4-[[1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 3121059 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4-[[1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCOc1cccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)C=CC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C24H25N3O8S/c1-2-35-18-5-3-4-17(14-18)27-22(29)15-20(24(27)32)26(21(28)10-11-23(30)31)13-12-16-6-8-19(9-7-16)36(25,33)34/h3-11,14,20H,2,12-13,15H2,1H3,(H,30,31)(H2,25,33,34) |
| InChIKey | WZXRKWXBWDUSIM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|