C23H31IN2O3 — CID 23802159
N-cycloheptyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 23802159) has the molecular formula C23H31IN2O3 and a molecular weight of 510.42 g/mol. Its IUPAC name is N-cycloheptyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-cycloheptyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23802159 |
| Molecular Formula | C23H31IN2O3 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-cycloheptyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(C1CCCCCC1)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C23H31IN2O3/c1-23(2,3)15-21(28)25(17-8-6-4-5-7-9-17)19-14-20(27)26(22(19)29)18-12-10-16(24)11-13-18/h10-13,17,19H,4-9,14-15H2,1-3H3 |
| InChIKey | BONMKWRNZSVVLB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|