C20H23N4O6+ — CID 53291762
ethyl 4-[3-[cyclopropyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 53291762) has the molecular formula C20H23N4O6+ and a molecular weight of 415.43 g/mol. Its IUPAC name is ethyl 4-[3-[cyclopropyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[cyclopropyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 53291762 |
| Molecular Formula | C20H23N4O6+ |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 4-[3-[cyclopropyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3c(=O)o[nH][n+]3C)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O6/c1-3-29-19(27)12-4-6-14(7-5-12)24-17(25)10-15(18(24)26)23(13-8-9-13)11-16-20(28)30-21-22(16)2/h4-7,13,15H,3,8-11H2,1-2H3/p+1 |
| InChIKey | QKLMQLOQMOGLTP-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|