C15H15ClN4O4 — CID 53291613
4-[[[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]methyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53291613) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is 4-[[[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]methyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]methyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291613 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-[[[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]methyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CN(Cc1c([O-])on[n+]1C)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C15H15ClN4O4/c1-18(8-12-15(23)24-17-19(12)2)11-7-13(21)20(14(11)22)10-5-3-9(16)4-6-10/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | GOEYUZLBCKCSHN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|